C17H13F9N2O3S — CID 101479021
(6-ethyl-3-methyl-2-pyridin-2-yl-4-pyridinyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 101479021) has the molecular formula C17H13F9N2O3S and a molecular weight of 496.35 g/mol. Its IUPAC name is (6-ethyl-3-methyl-2-pyridin-2-yl-4-pyridinyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (6-ethyl-3-methyl-2-pyridin-2-yl-4-pyridinyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 101479021 |
| Molecular Formula | C17H13F9N2O3S |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | (6-ethyl-3-methyl-2-pyridin-2-yl-4-pyridinyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCc1cc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(C)c(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H13F9N2O3S/c1-3-10-8-12(9(2)13(28-10)11-6-4-5-7-27-11)31-32(29,30)17(25,26)15(20,21)14(18,19)16(22,23)24/h4-8H,3H2,1-2H3 |
| InChIKey | GMAJTZOXZNFKDA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|