C16H26O5 — CID 101479290
(1R,5R,9Z,11S,14R)-14-(methoxymethoxy)-5-methyl-4,15-dioxabicyclo[9.3.1]pentadec-9-en-3-one (PubChem CID 101479290) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (1R,5R,9Z,11S,14R)-14-(methoxymethoxy)-5-methyl-4,15-dioxabicyclo[9.3.1]pentadec-9-en-3-one.
| Compound Name | (1R,5R,9Z,11S,14R)-14-(methoxymethoxy)-5-methyl-4,15-dioxabicyclo[9.3.1]pentadec-9-en-3-one |
|---|---|
| PubChem CID | 101479290 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (1R,5R,9Z,11S,14R)-14-(methoxymethoxy)-5-methyl-4,15-dioxabicyclo[9.3.1]pentadec-9-en-3-one |
| SMILES | COCO[C@@H]1CC[C@H]2/C=C\CCC[C@@H](C)OC(=O)C[C@H]1O2 |
| InChI | InChI=1S/C16H26O5/c1-12-6-4-3-5-7-13-8-9-14(19-11-18-2)15(21-13)10-16(17)20-12/h5,7,12-15H,3-4,6,8-11H2,1-2H3/b7-5-/t12-,13-,14-,15-/m1/s1 |
| InChIKey | LAHDOIWFFNABSQ-NDBFEMSLSA-N |
| XLogP | 2.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|