C15H17F2NO3 — CID 101479655
butyl (E)-3-(6-acetamido-2,3-difluorophenyl)prop-2-enoate (PubChem CID 101479655) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is butyl (E)-3-(6-acetamido-2,3-difluorophenyl)prop-2-enoate.
| Compound Name | butyl (E)-3-(6-acetamido-2,3-difluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 101479655 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | butyl (E)-3-(6-acetamido-2,3-difluorophenyl)prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1c(NC(C)=O)ccc(F)c1F |
| InChI | InChI=1S/C15H17F2NO3/c1-3-4-9-21-14(20)8-5-11-13(18-10(2)19)7-6-12(16)15(11)17/h5-8H,3-4,9H2,1-2H3,(H,18,19)/b8-5+ |
| InChIKey | SDNHXOLNMLJLHS-VMPITWQZSA-N |
| XLogP | 3.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|