C12H22O — CID 101480490
2-ethyl-4-hexyl-2,5-dihydrofuran (PubChem CID 101480490) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-ethyl-4-hexyl-2,5-dihydrofuran.
| Compound Name | 2-ethyl-4-hexyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 101480490 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2-ethyl-4-hexyl-2,5-dihydrofuran |
| SMILES | CCCCCCC1=CC(CC)OC1 |
| InChI | InChI=1S/C12H22O/c1-3-5-6-7-8-11-9-12(4-2)13-10-11/h9,12H,3-8,10H2,1-2H3 |
| InChIKey | XCYXPOWTQWMWRB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|