C40H69N3O4 — CID 101481437
N-(3,4,5-tris-decoxyphenyl)-1H-imidazole-5-carboxamide (PubChem CID 101481437) has the molecular formula C40H69N3O4 and a molecular weight of 656.01 g/mol. Its IUPAC name is N-(3,4,5-tris-decoxyphenyl)-1H-imidazole-5-carboxamide.
| Compound Name | N-(3,4,5-tris-decoxyphenyl)-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 101481437 |
| Molecular Formula | C40H69N3O4 |
| Molecular Weight | 656.01 g/mol |
| Exact Mass | 655.53 |
| IUPAC Name | N-(3,4,5-tris-decoxyphenyl)-1H-imidazole-5-carboxamide |
| SMILES | CCCCCCCCCCOc1cc(NC(=O)c2cnc[nH]2)cc(OCCCCCCCCCC)c1OCCCCCCCCCC |
| InChI | InChI=1S/C40H69N3O4/c1-4-7-10-13-16-19-22-25-28-45-37-31-35(43-40(44)36-33-41-34-42-36)32-38(46-29-26-23-20-17-14-11-8-5-2)39(37)47-30-27-24-21-18-15-12-9-6-3/h31-34H,4-30H2,1-3H3,(H,41,42)(H,43,44) |
| InChIKey | PSORDDBHJQTZJP-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.01 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|