C82H140N6O10 — CID 101135693
1-[(3,4,5-tris-decoxybenzoyl)amino]-3-[4-[[(3,4,5-tris-decoxybenzoyl)amino]carbamoylamino]phenyl]urea (PubChem CID 101135693) has the molecular formula C82H140N6O10 and a molecular weight of 1370.05 g/mol. Its IUPAC name is 1-[(3,4,5-tris-decoxybenzoyl)amino]-3-[4-[[(3,4,5-tris-decoxybenzoyl)amino]carbamoylamino]phenyl]urea.
| Compound Name | 1-[(3,4,5-tris-decoxybenzoyl)amino]-3-[4-[[(3,4,5-tris-decoxybenzoyl)amino]carbamoylamino]phenyl]urea |
|---|---|
| PubChem CID | 101135693 |
| Molecular Formula | C82H140N6O10 |
| Molecular Weight | 1370.05 g/mol |
| Exact Mass | 1369.06 |
| IUPAC Name | 1-[(3,4,5-tris-decoxybenzoyl)amino]-3-[4-[[(3,4,5-tris-decoxybenzoyl)amino]carbamoylamino]phenyl]urea |
| SMILES | CCCCCCCCCCOc1cc(C(=O)NNC(=O)Nc2ccc(NC(=O)NNC(=O)c3cc(OCCCCCCCCCC)c(OCCCCCCCCCC)c(OCCCCCCCCCC)c3)cc2)cc(OCCCCCCCCCC)c1OCCCCCCCCCC |
| InChI | InChI=1S/C82H140N6O10/c1-7-13-19-25-31-37-43-49-59-93-73-65-69(66-74(94-60-50-44-38-32-26-20-14-8-2)77(73)97-63-53-47-41-35-29-23-17-11-5)79(89)85-87-81(91)83-71-55-57-72(58-56-71)84-82(92)88-86-80(90)70-67-75(95-61-51-45-39-33-27-21-15-9-3)78(98-64-54-48-42-36-30-24-18-12-6)76(68-70)96-62-52-46-40-34-28-22-16-10-4/h55-58,65-68H,7-54,59-64H2,1-6H3,(H,85,89)(H,86,90)(H2,83,87,91)(H2,84,88,92) |
| InChIKey | ADPZRJYTGNLBPC-UHFFFAOYSA-N |
| XLogP | 23.74 |
| TPSA | 195.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 64 |
| Heavy Atoms | 98 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1370.05 |
| LogP ≤ 5 | 23.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|