C67H114Br6N2O7 — CID 102343460
1,3-bis[3,4,5-tris(9-bromononoxy)phenyl]urea (PubChem CID 102343460) has the molecular formula C67H114Br6N2O7 and a molecular weight of 1539.08 g/mol. Its IUPAC name is 1,3-bis[3,4,5-tris(9-bromononoxy)phenyl]urea.
| Compound Name | 1,3-bis[3,4,5-tris(9-bromononoxy)phenyl]urea |
|---|---|
| PubChem CID | 102343460 |
| Molecular Formula | C67H114Br6N2O7 |
| Molecular Weight | 1539.08 g/mol |
| Exact Mass | 1532.37 |
| IUPAC Name | 1,3-bis[3,4,5-tris(9-bromononoxy)phenyl]urea |
| SMILES | O=C(Nc1cc(OCCCCCCCCCBr)c(OCCCCCCCCCBr)c(OCCCCCCCCCBr)c1)Nc1cc(OCCCCCCCCCBr)c(OCCCCCCCCCBr)c(OCCCCCCCCCBr)c1 |
| InChI | InChI=1S/C67H114Br6N2O7/c68-43-31-19-7-1-13-25-37-49-77-61-55-59(56-62(78-50-38-26-14-2-8-20-32-44-69)65(61)81-53-41-29-17-5-11-23-35-47-72)74-67(76)75-60-57-63(79-51-39-27-15-3-9-21-33-45-70)66(82-54-42-30-18-6-12-24-36-48-73)64(58-60)80-52-40-28-16-4-10-22-34-46-71/h55-58H,1-54H2,(H2,74,75,76) |
| InChIKey | IESABIVDOXXBCM-UHFFFAOYSA-N |
| XLogP | 24.36 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 62 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1539.08 |
| LogP ≤ 5 | 24.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|