C20H24O5 — CID 101481863
(3S,3aS,6aR,9aR,9bS)-6,9-dimethylidene-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethyl]-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-2-one (PubChem CID 101481863) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3S,3aS,6aR,9aR,9bS)-6,9-dimethylidene-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethyl]-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-2-one.
| Compound Name | (3S,3aS,6aR,9aR,9bS)-6,9-dimethylidene-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethyl]-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 101481863 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (3S,3aS,6aR,9aR,9bS)-6,9-dimethylidene-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]oxymethyl]-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-2-one |
| SMILES | C=C1CC[C@H]2C(=C)CC[C@@H]3[C@H](OC(=O)[C@@H]3CO[C@@H]3C=C(C)C(=O)O3)[C@@H]12 |
| InChI | InChI=1S/C20H24O5/c1-10-4-7-14-15(9-23-16-8-12(3)19(21)24-16)20(22)25-18(14)17-11(2)5-6-13(10)17/h8,13-18H,1-2,4-7,9H2,3H3/t13-,14-,15+,16-,17-,18-/m0/s1 |
| InChIKey | PHZLOFPYMVYKEF-PCCRXHMLSA-N |
| XLogP | 2.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|