C9H10OS — CID 101484628
(7S)-4,5,6,7-tetrahydro-1-benzothiophene-7-carbaldehyde (PubChem CID 101484628) has the molecular formula C9H10OS and a molecular weight of 166.25 g/mol. Its IUPAC name is (7S)-4,5,6,7-tetrahydro-1-benzothiophene-7-carbaldehyde.
| Compound Name | (7S)-4,5,6,7-tetrahydro-1-benzothiophene-7-carbaldehyde |
|---|---|
| PubChem CID | 101484628 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | (7S)-4,5,6,7-tetrahydro-1-benzothiophene-7-carbaldehyde |
| SMILES | O=C[C@@H]1CCCc2ccsc21 |
| InChI | InChI=1S/C9H10OS/c10-6-8-3-1-2-7-4-5-11-9(7)8/h4-6,8H,1-3H2/t8-/m0/s1 |
| InChIKey | INUNXMHIGUDQAP-QMMMGPOBSA-N |
| XLogP | 2.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|