C18H25BO3 — CID 101484684
(3R)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-one (PubChem CID 101484684) has the molecular formula C18H25BO3 and a molecular weight of 300.21 g/mol. Its IUPAC name is (3R)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-one.
| Compound Name | (3R)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 101484684 |
| Molecular Formula | C18H25BO3 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (3R)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-one |
| SMILES | CC1(C)OB([C@@]2(c3ccccc3)CCCC(=O)C2)OC1(C)C |
| InChI | InChI=1S/C18H25BO3/c1-16(2)17(3,4)22-19(21-16)18(12-8-11-15(20)13-18)14-9-6-5-7-10-14/h5-7,9-10H,8,11-13H2,1-4H3/t18-/m0/s1 |
| InChIKey | FBVZTIXQMVYEPK-SFHVURJKSA-N |
| XLogP | 3.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|