C17H23BO3 — CID 135062360
(3S)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-one (PubChem CID 135062360) has the molecular formula C17H23BO3 and a molecular weight of 286.18 g/mol. Its IUPAC name is (3S)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-one.
| Compound Name | (3S)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-one |
|---|---|
| PubChem CID | 135062360 |
| Molecular Formula | C17H23BO3 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (3S)-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopentan-1-one |
| SMILES | CC1(C)OB([C@]2(c3ccccc3)CCC(=O)C2)OC1(C)C |
| InChI | InChI=1S/C17H23BO3/c1-15(2)16(3,4)21-18(20-15)17(11-10-14(19)12-17)13-8-6-5-7-9-13/h5-9H,10-12H2,1-4H3/t17-/m1/s1 |
| InChIKey | SUDJQOTZUNTIJF-QGZVFWFLSA-N |
| XLogP | 3.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|