C19H24O2 — CID 50923912
trans-(3R,4R)-4-(3,3-dimethylbut-1-ynyl)-3-hydroxy-4-methyl-3-phenylcyclohexan-1-one (PubChem CID 50923912) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is trans-(3R,4R)-4-(3,3-dimethylbut-1-ynyl)-3-hydroxy-4-methyl-3-phenylcyclohexan-1-one.
| Compound Name | trans-(3R,4R)-4-(3,3-dimethylbut-1-ynyl)-3-hydroxy-4-methyl-3-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 50923912 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | trans-(3R,4R)-4-(3,3-dimethylbut-1-ynyl)-3-hydroxy-4-methyl-3-phenylcyclohexan-1-one |
| SMILES | CC(C)(C)C#C[C@@]1(C)CCC(=O)C[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C19H24O2/c1-17(2,3)12-13-18(4)11-10-16(20)14-19(18,21)15-8-6-5-7-9-15/h5-9,21H,10-11,14H2,1-4H3/t18-,19-/m1/s1 |
| InChIKey | PJQWJCZPMKIDPC-RTBURBONSA-N |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|