C18H22O2 — CID 101485601
(1S,2R,4S,5R)-2-benzyl-4-butyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 101485601) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S,2R,4S,5R)-2-benzyl-4-butyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2R,4S,5R)-2-benzyl-4-butyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 101485601 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (1S,2R,4S,5R)-2-benzyl-4-butyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CCCC[C@@H]1C(=O)[C@H](Cc2ccccc2)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C18H22O2/c1-2-3-9-14-16-10-11-17(20-16)15(18(14)19)12-13-7-5-4-6-8-13/h4-8,10-11,14-17H,2-3,9,12H2,1H3/t14-,15+,16+,17-/m0/s1 |
| InChIKey | ZFQPPLRFLBTEOE-HZMVEIRTSA-N |
| XLogP | 3.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|