C21H28O4 — CID 44584728
methyl 2-[(3S,4R,6R)-4,6-dimethyl-6-[(2E,4E)-6-phenylhexa-2,4-dien-2-yl]dioxan-3-yl]acetate (PubChem CID 44584728) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is methyl 2-[(3S,4R,6R)-4,6-dimethyl-6-[(2E,4E)-6-phenylhexa-2,4-dien-2-yl]dioxan-3-yl]acetate.
| Compound Name | methyl 2-[(3S,4R,6R)-4,6-dimethyl-6-[(2E,4E)-6-phenylhexa-2,4-dien-2-yl]dioxan-3-yl]acetate |
|---|---|
| PubChem CID | 44584728 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | methyl 2-[(3S,4R,6R)-4,6-dimethyl-6-[(2E,4E)-6-phenylhexa-2,4-dien-2-yl]dioxan-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1OO[C@@](C)(/C(C)=C/C=C/Cc2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C21H28O4/c1-16-15-21(3,25-24-19(16)14-20(22)23-4)17(2)10-8-9-13-18-11-6-5-7-12-18/h5-12,16,19H,13-15H2,1-4H3/b9-8+,17-10+/t16-,19+,21-/m1/s1 |
| InChIKey | ZCPLBHZTIUDJKV-CDATVAOKSA-N |
| XLogP | 4.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|