C11H22O2 — CID 101486968
(2S,3S)-3-[(2S)-butan-2-yl]-2-methylhex-5-ene-1,3-diol (PubChem CID 101486968) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (2S,3S)-3-[(2S)-butan-2-yl]-2-methylhex-5-ene-1,3-diol.
| Compound Name | (2S,3S)-3-[(2S)-butan-2-yl]-2-methylhex-5-ene-1,3-diol |
|---|---|
| PubChem CID | 101486968 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (2S,3S)-3-[(2S)-butan-2-yl]-2-methylhex-5-ene-1,3-diol |
| SMILES | C=CC[C@](O)([C@@H](C)CC)[C@@H](C)CO |
| InChI | InChI=1S/C11H22O2/c1-5-7-11(13,9(3)6-2)10(4)8-12/h5,9-10,12-13H,1,6-8H2,2-4H3/t9-,10-,11-/m0/s1 |
| InChIKey | LVYLMSFLEOMRPX-DCAQKATOSA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|