C12H25BO3 — CID 101487032
(2S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-2-ol (PubChem CID 101487032) has the molecular formula C12H25BO3 and a molecular weight of 228.14 g/mol. Its IUPAC name is (2S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-2-ol.
| Compound Name | (2S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-2-ol |
|---|---|
| PubChem CID | 101487032 |
| Molecular Formula | C12H25BO3 |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | (2S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-2-ol |
| SMILES | C[C@H](O)CCCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H25BO3/c1-10(14)8-6-7-9-13-15-11(2,3)12(4,5)16-13/h10,14H,6-9H2,1-5H3/t10-/m0/s1 |
| InChIKey | ICQOGEACNACXAQ-JTQLQIEISA-N |
| XLogP | 2.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|