C12H25BO3 — CID 154712875
4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol (PubChem CID 154712875) has the molecular formula C12H25BO3 and a molecular weight of 228.14 g/mol. Its IUPAC name is 4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol.
| Compound Name | 4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol |
|---|---|
| PubChem CID | 154712875 |
| Molecular Formula | C12H25BO3 |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol |
| SMILES | CC(C)CC(O)CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H25BO3/c1-9(2)7-10(14)8-13-15-11(3,4)12(5,6)16-13/h9-10,14H,7-8H2,1-6H3 |
| InChIKey | VUCBXZXJJAKRLP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|