C21H23NO3S — CID 101488137
2-[(1R,3R,5S)-2-(4-methylphenyl)sulfonyl-3-phenyl-2-azabicyclo[3.2.0]heptan-1-yl]acetaldehyde (PubChem CID 101488137) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 2-[(1R,3R,5S)-2-(4-methylphenyl)sulfonyl-3-phenyl-2-azabicyclo[3.2.0]heptan-1-yl]acetaldehyde.
| Compound Name | 2-[(1R,3R,5S)-2-(4-methylphenyl)sulfonyl-3-phenyl-2-azabicyclo[3.2.0]heptan-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 101488137 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-[(1R,3R,5S)-2-(4-methylphenyl)sulfonyl-3-phenyl-2-azabicyclo[3.2.0]heptan-1-yl]acetaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](c3ccccc3)C[C@@H]3CC[C@@]32CC=O)cc1 |
| InChI | InChI=1S/C21H23NO3S/c1-16-7-9-19(10-8-16)26(24,25)22-20(17-5-3-2-4-6-17)15-18-11-12-21(18,22)13-14-23/h2-10,14,18,20H,11-13,15H2,1H3/t18-,20+,21+/m0/s1 |
| InChIKey | HPGVXUGUIOQVRJ-CEWLAPEOSA-N |
| XLogP | 3.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|