C26H40O10 — CID 101488418
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoyl]oxyoxan-2-yl]methyl (4R)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carboxylate (PubChem CID 101488418) has the molecular formula C26H40O10 and a molecular weight of 512.60 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoyl]oxyoxan-2-yl]methyl (4R)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carboxylate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoyl]oxyoxan-2-yl]methyl (4R)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 101488418 |
| Molecular Formula | C26H40O10 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoyl]oxyoxan-2-yl]methyl (4R)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carboxylate |
| SMILES | C=CC(C)(O)CC/C=C(\C)C(=O)O[C@@H]1O[C@H](COC(=O)C2=CC[C@H](C(C)(C)O)CC2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H40O10/c1-6-26(5,33)13-7-8-15(2)22(30)36-24-21(29)20(28)19(27)18(35-24)14-34-23(31)16-9-11-17(12-10-16)25(3,4)32/h6,8-9,17-21,24,27-29,32-33H,1,7,10-14H2,2-5H3/b15-8+/t17-,18+,19+,20-,21+,24-,26?/m0/s1 |
| InChIKey | KVTIZLAHBNDPGT-YAIJNECLSA-N |
| XLogP | 1.04 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|