C23H36O12 — CID 124906198
(3S)-3-hydroxy-3-methyl-5-oxo-5-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-[(3R,6E)-8-methoxy-3,7-dimethyl-8-oxoocta-1,6-dien-3-yl]oxyoxan-2-yl]methoxy]pentanoic acid (PubChem CID 124906198) has the molecular formula C23H36O12 and a molecular weight of 504.53 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-methyl-5-oxo-5-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-[(3R,6E)-8-methoxy-3,7-dimethyl-8-oxoocta-1,6-dien-3-yl]oxyoxan-2-yl]methoxy]pentanoic acid.
| Compound Name | (3S)-3-hydroxy-3-methyl-5-oxo-5-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-[(3R,6E)-8-methoxy-3,7-dimethyl-8-oxoocta-1,6-dien-3-yl]oxyoxan-2-yl]methoxy]pentanoic acid |
|---|---|
| PubChem CID | 124906198 |
| Molecular Formula | C23H36O12 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | (3S)-3-hydroxy-3-methyl-5-oxo-5-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-[(3R,6E)-8-methoxy-3,7-dimethyl-8-oxoocta-1,6-dien-3-yl]oxyoxan-2-yl]methoxy]pentanoic acid |
| SMILES | C=C[C@@](C)(CC/C=C(\C)C(=O)OC)O[C@H]1O[C@@H](COC(=O)C[C@@](C)(O)CC(=O)O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H36O12/c1-6-23(4,9-7-8-13(2)20(30)32-5)35-21-19(29)18(28)17(27)14(34-21)12-33-16(26)11-22(3,31)10-15(24)25/h6,8,14,17-19,21,27-29,31H,1,7,9-12H2,2-5H3,(H,24,25)/b13-8+/t14-,17-,18+,19-,21+,22-,23-/m0/s1 |
| InChIKey | LVOGPECZHVNNHD-NPXPPSBWSA-N |
| XLogP | -0.19 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|