C31H44O12 — CID 162891096
[6-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,5-dihydroxy-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 162891096) has the molecular formula C31H44O12 and a molecular weight of 608.68 g/mol. Its IUPAC name is [6-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,5-dihydroxy-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [6-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,5-dihydroxy-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162891096 |
| Molecular Formula | C31H44O12 |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | [6-(3,7-dimethylocta-1,6-dien-3-yloxy)-3,5-dihydroxy-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C=CC(C)(CCC=C(C)C)OC1OC(COC(=O)C=Cc2ccc(O)cc2)C(O)C(OC2OC(C)C(O)C(O)C2O)C1O |
| InChI | InChI=1S/C31H44O12/c1-6-31(5,15-7-8-17(2)3)43-30-27(38)28(42-29-26(37)25(36)23(34)18(4)40-29)24(35)21(41-30)16-39-22(33)14-11-19-9-12-20(32)13-10-19/h6,8-14,18,21,23-30,32,34-38H,1,7,15-16H2,2-5H3 |
| InChIKey | PBSSXKRXMOFPNP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 184.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|