C27H50N6O6Si — CID 101491540
3-[2-[2-[2-[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxymethyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]prop-1-ynyl-tri(propan-2-yl)silane (PubChem CID 101491540) has the molecular formula C27H50N6O6Si and a molecular weight of 582.82 g/mol. Its IUPAC name is 3-[2-[2-[2-[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxymethyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]prop-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 3-[2-[2-[2-[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxymethyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]prop-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101491540 |
| Molecular Formula | C27H50N6O6Si |
| Molecular Weight | 582.82 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | 3-[2-[2-[2-[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxymethyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]prop-1-ynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CCOCCOCCOCCn1cc(COCCOCCOCCN=[N+]=[N-])nn1)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H50N6O6Si/c1-24(2)40(25(3)4,26(5)6)21-7-10-34-13-16-37-18-15-36-12-9-33-22-27(30-32-33)23-39-20-19-38-17-14-35-11-8-29-31-28/h22,24-26H,8-20,23H2,1-6H3 |
| InChIKey | XTBOLYBQROSBNW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 134.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.82 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|