C24H26Br2F2N6O2 — CID 167533396
1-azido-2-fluoroethane;4-[(4-bromophenyl)methoxymethyl]-1-(2-fluoroethyl)triazole;1-bromo-4-(prop-2-ynoxymethyl)benzene (PubChem CID 167533396) has the molecular formula C24H26Br2F2N6O2 and a molecular weight of 628.32 g/mol. Its IUPAC name is 1-azido-2-fluoroethane;4-[(4-bromophenyl)methoxymethyl]-1-(2-fluoroethyl)triazole;1-bromo-4-(prop-2-ynoxymethyl)benzene.
| Compound Name | 1-azido-2-fluoroethane;4-[(4-bromophenyl)methoxymethyl]-1-(2-fluoroethyl)triazole;1-bromo-4-(prop-2-ynoxymethyl)benzene |
|---|---|
| PubChem CID | 167533396 |
| Molecular Formula | C24H26Br2F2N6O2 |
| Molecular Weight | 628.32 g/mol |
| Exact Mass | 626.05 |
| IUPAC Name | 1-azido-2-fluoroethane;4-[(4-bromophenyl)methoxymethyl]-1-(2-fluoroethyl)triazole;1-bromo-4-(prop-2-ynoxymethyl)benzene |
| SMILES | C#CCOCc1ccc(Br)cc1.FCCn1cc(COCc2ccc(Br)cc2)nn1.[N-]=[N+]=NCCF |
| InChI | InChI=1S/C12H13BrFN3O.C10H9BrO.C2H4FN3/c13-11-3-1-10(2-4-11)8-18-9-12-7-17(6-5-14)16-15-12;1-2-7-12-8-9-3-5-10(11)6-4-9;3-1-2-5-6-4/h1-4,7H,5-6,8-9H2;1,3-6H,7-8H2;1-2H2 |
| InChIKey | AGOVLQOOBPQNFF-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.32 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|