C23H47N9O8S — CID 162049312
2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanamine;2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethanamine (PubChem CID 162049312) has the molecular formula C23H47N9O8S and a molecular weight of 609.75 g/mol. Its IUPAC name is 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanamine;2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanamine;2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 162049312 |
| Molecular Formula | C23H47N9O8S |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.33 |
| IUPAC Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanamine;2-[2-[2-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]ethanamine |
| SMILES | NCCOCCOCCOCCn1cc(CN2CCS(=O)(=O)CC2)nn1.[N-]=[N+]=NCCOCCOCCOCCN |
| InChI | InChI=1S/C15H29N5O5S.C8H18N4O3/c16-1-5-23-7-9-25-10-8-24-6-2-20-14-15(17-18-20)13-19-3-11-26(21,22)12-4-19;9-1-3-13-5-7-15-8-6-14-4-2-11-12-10/h14H,1-13,16H2;1-9H2 |
| InChIKey | YYIKXMXFCMRCSS-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 224.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|