C21H23N3O3 — CID 101492217
N-benzyl-2-methyl-2-(7-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)propanamide (PubChem CID 101492217) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-benzyl-2-methyl-2-(7-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)propanamide.
| Compound Name | N-benzyl-2-methyl-2-(7-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)propanamide |
|---|---|
| PubChem CID | 101492217 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-benzyl-2-methyl-2-(7-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)propanamide |
| SMILES | Cc1ccc2c(c1)NC(=O)C(C(C)(C)C(=O)NCc1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C21H23N3O3/c1-13-9-10-15-16(11-13)24-19(26)17(18(25)23-15)21(2,3)20(27)22-12-14-7-5-4-6-8-14/h4-11,17H,12H2,1-3H3,(H,22,27)(H,23,25)(H,24,26) |
| InChIKey | ICDTVNRFTAEISN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|