C20H21N3O3 — CID 101492214
N-benzyl-2-(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)-2-methylpropanamide (PubChem CID 101492214) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-benzyl-2-(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)-2-methylpropanamide.
| Compound Name | N-benzyl-2-(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 101492214 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-benzyl-2-(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NCc1ccccc1)C1C(=O)Nc2ccccc2NC1=O |
| InChI | InChI=1S/C20H21N3O3/c1-20(2,19(26)21-12-13-8-4-3-5-9-13)16-17(24)22-14-10-6-7-11-15(14)23-18(16)25/h3-11,16H,12H2,1-2H3,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | PYXNNBACLBSQBK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|