C14H17ClO2S — CID 101492882
S-(4-chlorophenyl) 5,5-dimethyl-3-oxohexanethioate (PubChem CID 101492882) has the molecular formula C14H17ClO2S and a molecular weight of 284.81 g/mol. Its IUPAC name is S-(4-chlorophenyl) 5,5-dimethyl-3-oxohexanethioate.
| Compound Name | S-(4-chlorophenyl) 5,5-dimethyl-3-oxohexanethioate |
|---|---|
| PubChem CID | 101492882 |
| Molecular Formula | C14H17ClO2S |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | S-(4-chlorophenyl) 5,5-dimethyl-3-oxohexanethioate |
| SMILES | CC(C)(C)CC(=O)CC(=O)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClO2S/c1-14(2,3)9-11(16)8-13(17)18-12-6-4-10(15)5-7-12/h4-7H,8-9H2,1-3H3 |
| InChIKey | YVUIUYUKOCIKQS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|