C46H50N4O2 — CID 101493138
2-(4-tert-butylphenyl)-5-[2,6-ditert-butyl-10-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]anthracen-9-yl]-1,3,4-oxadiazole (PubChem CID 101493138) has the molecular formula C46H50N4O2 and a molecular weight of 690.93 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-[2,6-ditert-butyl-10-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]anthracen-9-yl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-tert-butylphenyl)-5-[2,6-ditert-butyl-10-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]anthracen-9-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 101493138 |
| Molecular Formula | C46H50N4O2 |
| Molecular Weight | 690.93 g/mol |
| Exact Mass | 690.39 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-[2,6-ditert-butyl-10-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]anthracen-9-yl]-1,3,4-oxadiazole |
| SMILES | CC(C)(C)c1ccc(-c2nnc(-c3c4ccc(C(C)(C)C)cc4c(-c4nnc(-c5ccc(C(C)(C)C)cc5)o4)c4ccc(C(C)(C)C)cc34)o2)cc1 |
| InChI | InChI=1S/C46H50N4O2/c1-43(2,3)29-17-13-27(14-18-29)39-47-49-41(51-39)37-33-23-21-32(46(10,11)12)26-36(33)38(34-24-22-31(25-35(34)37)45(7,8)9)42-50-48-40(52-42)28-15-19-30(20-16-28)44(4,5)6/h13-26H,1-12H3 |
| InChIKey | ZULTVXLCIQIJDJ-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.93 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|