C22H21NO3 — CID 101495102
(3E)-1-(4-hydroxyphenyl)-3-[1-(4-methylphenyl)ethylidene]-4-propan-2-ylidenepyrrolidine-2,5-dione (PubChem CID 101495102) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (3E)-1-(4-hydroxyphenyl)-3-[1-(4-methylphenyl)ethylidene]-4-propan-2-ylidenepyrrolidine-2,5-dione.
| Compound Name | (3E)-1-(4-hydroxyphenyl)-3-[1-(4-methylphenyl)ethylidene]-4-propan-2-ylidenepyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 101495102 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (3E)-1-(4-hydroxyphenyl)-3-[1-(4-methylphenyl)ethylidene]-4-propan-2-ylidenepyrrolidine-2,5-dione |
| SMILES | CC(C)=C1C(=O)N(c2ccc(O)cc2)C(=O)/C1=C(\C)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H21NO3/c1-13(2)19-20(15(4)16-7-5-14(3)6-8-16)22(26)23(21(19)25)17-9-11-18(24)12-10-17/h5-12,24H,1-4H3/b20-15+ |
| InChIKey | KXHJOVYKUQEKON-HMMYKYKNSA-N |
| XLogP | 4.38 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|