C11H21IOSi — CID 101495840
[(2S,6R)-6-ethyl-4-iodo-2-methyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane (PubChem CID 101495840) has the molecular formula C11H21IOSi and a molecular weight of 324.28 g/mol. Its IUPAC name is [(2S,6R)-6-ethyl-4-iodo-2-methyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane.
| Compound Name | [(2S,6R)-6-ethyl-4-iodo-2-methyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101495840 |
| Molecular Formula | C11H21IOSi |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | [(2S,6R)-6-ethyl-4-iodo-2-methyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane |
| SMILES | CC[C@H]1O[C@@H](C)CC(I)=C1[Si](C)(C)C |
| InChI | InChI=1S/C11H21IOSi/c1-6-10-11(14(3,4)5)9(12)7-8(2)13-10/h8,10H,6-7H2,1-5H3/t8-,10+/m0/s1 |
| InChIKey | IMUQBQRKUFFTFB-WCBMZHEXSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|