C10H19OSi+ — CID 135042012
(2,6-dimethyl-2,3,4,6-tetrahydropyran-4-ylium-5-yl)-trimethylsilane (PubChem CID 135042012) has the molecular formula C10H19OSi+ and a molecular weight of 183.35 g/mol. Its IUPAC name is (2,6-dimethyl-2,3,4,6-tetrahydropyran-4-ylium-5-yl)-trimethylsilane.
| Compound Name | (2,6-dimethyl-2,3,4,6-tetrahydropyran-4-ylium-5-yl)-trimethylsilane |
|---|---|
| PubChem CID | 135042012 |
| Molecular Formula | C10H19OSi+ |
| Molecular Weight | 183.35 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | (2,6-dimethyl-2,3,4,6-tetrahydropyran-4-ylium-5-yl)-trimethylsilane |
| SMILES | CC1C[C+]=C([Si](C)(C)C)C(C)O1 |
| InChI | InChI=1S/C10H19OSi/c1-8-6-7-10(9(2)11-8)12(3,4)5/h8-9H,6H2,1-5H3/q+1 |
| InChIKey | LXEPZRLPYXIAIA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|