C12H23IOSi — CID 101495836
[(2S,6R)-4-iodo-2-methyl-6-propyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane (PubChem CID 101495836) has the molecular formula C12H23IOSi and a molecular weight of 338.31 g/mol. Its IUPAC name is [(2S,6R)-4-iodo-2-methyl-6-propyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane.
| Compound Name | [(2S,6R)-4-iodo-2-methyl-6-propyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101495836 |
| Molecular Formula | C12H23IOSi |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [(2S,6R)-4-iodo-2-methyl-6-propyl-3,6-dihydro-2H-pyran-5-yl]-trimethylsilane |
| SMILES | CCC[C@H]1O[C@@H](C)CC(I)=C1[Si](C)(C)C |
| InChI | InChI=1S/C12H23IOSi/c1-6-7-11-12(15(3,4)5)10(13)8-9(2)14-11/h9,11H,6-8H2,1-5H3/t9-,11+/m0/s1 |
| InChIKey | LNBWBSCIUSSDRR-GXSJLCMTSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|