C23H47NSi5 — CID 101495924
[1-benzylimino-2,5,5-tris(trimethylsilyl)silolan-2-yl]-trimethylsilane (PubChem CID 101495924) has the molecular formula C23H47NSi5 and a molecular weight of 478.07 g/mol. Its IUPAC name is [1-benzylimino-2,5,5-tris(trimethylsilyl)silolan-2-yl]-trimethylsilane.
| Compound Name | [1-benzylimino-2,5,5-tris(trimethylsilyl)silolan-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101495924 |
| Molecular Formula | C23H47NSi5 |
| Molecular Weight | 478.07 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | [1-benzylimino-2,5,5-tris(trimethylsilyl)silolan-2-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1([Si](C)(C)C)CCC([Si](C)(C)C)([Si](C)(C)C)[Si]1=NCc1ccccc1 |
| InChI | InChI=1S/C23H47NSi5/c1-26(2,3)22(27(4,5)6)18-19-23(28(7,8)9,29(10,11)12)25(22)24-20-21-16-14-13-15-17-21/h13-17H,18-20H2,1-12H3 |
| InChIKey | INHYAYWTHQXESJ-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.07 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|