C21H32O4S — CID 101497186
benzyl (2S,3R)-3-octyl-1,1-dioxothiane-2-carboxylate (PubChem CID 101497186) has the molecular formula C21H32O4S and a molecular weight of 380.55 g/mol. Its IUPAC name is benzyl (2S,3R)-3-octyl-1,1-dioxothiane-2-carboxylate.
| Compound Name | benzyl (2S,3R)-3-octyl-1,1-dioxothiane-2-carboxylate |
|---|---|
| PubChem CID | 101497186 |
| Molecular Formula | C21H32O4S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | benzyl (2S,3R)-3-octyl-1,1-dioxothiane-2-carboxylate |
| SMILES | CCCCCCCC[C@@H]1CCCS(=O)(=O)[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H32O4S/c1-2-3-4-5-6-10-14-19-15-11-16-26(23,24)20(19)21(22)25-17-18-12-8-7-9-13-18/h7-9,12-13,19-20H,2-6,10-11,14-17H2,1H3/t19-,20+/m1/s1 |
| InChIKey | PMPBHDRKLIAQTI-UXHICEINSA-N |
| XLogP | 4.67 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|