C16H25NO8 — CID 101497486
6-O,7-O-diethyl 1-O-methyl 5-nitrooct-7-ene-1,6,7-tricarboxylate (PubChem CID 101497486) has the molecular formula C16H25NO8 and a molecular weight of 359.38 g/mol. Its IUPAC name is 6-O,7-O-diethyl 1-O-methyl 5-nitrooct-7-ene-1,6,7-tricarboxylate.
| Compound Name | 6-O,7-O-diethyl 1-O-methyl 5-nitrooct-7-ene-1,6,7-tricarboxylate |
|---|---|
| PubChem CID | 101497486 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 6-O,7-O-diethyl 1-O-methyl 5-nitrooct-7-ene-1,6,7-tricarboxylate |
| SMILES | C=C(C(=O)OCC)C(C(=O)OCC)C(CCCCC(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C16H25NO8/c1-5-24-15(19)11(3)14(16(20)25-6-2)12(17(21)22)9-7-8-10-13(18)23-4/h12,14H,3,5-10H2,1-2,4H3 |
| InChIKey | FPCWAQKCLLDZMD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|