C24H42N2O8 — CID 161177225
ethyl 4,7-dimethyl-11-(3-methyl-2-methylidenebutanoyl)oxy-4,8-dinitro-2-propan-2-ylundecanoate (PubChem CID 161177225) has the molecular formula C24H42N2O8 and a molecular weight of 486.61 g/mol. Its IUPAC name is ethyl 4,7-dimethyl-11-(3-methyl-2-methylidenebutanoyl)oxy-4,8-dinitro-2-propan-2-ylundecanoate.
| Compound Name | ethyl 4,7-dimethyl-11-(3-methyl-2-methylidenebutanoyl)oxy-4,8-dinitro-2-propan-2-ylundecanoate |
|---|---|
| PubChem CID | 161177225 |
| Molecular Formula | C24H42N2O8 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | ethyl 4,7-dimethyl-11-(3-methyl-2-methylidenebutanoyl)oxy-4,8-dinitro-2-propan-2-ylundecanoate |
| SMILES | C=C(C(=O)OCCCC(C(C)CCC(C)(CC(C(=O)OCC)C(C)C)[N+](=O)[O-])[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C24H42N2O8/c1-9-33-23(28)20(17(4)5)15-24(8,26(31)32)13-12-18(6)21(25(29)30)11-10-14-34-22(27)19(7)16(2)3/h16-18,20-21H,7,9-15H2,1-6,8H3 |
| InChIKey | URYXMWHNOABOHZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|