About ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane
ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane (PubChem CID 158227579) has the molecular formula C22H42N2O8
and a molecular weight of 462.58 g/mol. Its IUPAC name is ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane.
Molecular Properties
| Compound Name | ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane |
| PubChem CID | 158227579 |
| Molecular Formula | C22H42N2O8 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane |
| SMILES | C=C(C(=O)OCC)C(C)C.CC(C)[N+](=O)[O-].CCOC(=O)C(CC(C)(C)[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C11H21NO4.C8H14O2.C3H7NO2/c1-6-16-10(13)9(8(2)3)7-11(4,5)12(14)15;1-5-10-8(9)7(4)6(2)3;1-3(2)4(5)6/h8-9H,6-7H2,1-5H3;6H,4-5H2,1-3H3;3H,1-2H3 |
| InChIKey | GDZHBWQNVWRPOL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane?
The IUPAC name of ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane (CID 158227579) is ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane.
What is the SMILES notation for ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane?
The canonical SMILES for ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane is C=C(C(=O)OCC)C(C)C.CC(C)[N+](=O)[O-].CCOC(=O)C(CC(C)(C)[N+](=O)[O-])C(C)C.
What is the InChIKey of ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane?
The InChIKey is GDZHBWQNVWRPOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4.C8H14O2.C3H7NO2/c1-6-16-10(13)9(8(2)3)7-11(4,5)12(14)15;1-5-10-8(9)7(4)6(2)3;1-3(2)4(5)6/h8-9H,6-7H2,1-5H3;6H,4-5H2,1-3H3;3H,1-2H3.
What are the key properties of ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane?
ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane has a molecular weight of 462.58 g/mol, XLogP of 4.70, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methyl-2-methylidenebutanoate;ethyl 4-methyl-4-nitro-2-propan-2-ylpentanoate;2-nitropropane is sourced from PubChem (CID 158227579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).