About 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane
3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane (PubChem CID 167603539) has the molecular formula C22H38N2O8
and a molecular weight of 458.55 g/mol. Its IUPAC name is 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane.
Molecular Properties
| Compound Name | 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane |
| PubChem CID | 167603539 |
| Molecular Formula | C22H38N2O8 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane |
| SMILES | C=C1CCCOC1=O.CCCC(C)(CC1CCCOC1=O)[N+](=O)[O-].CCCC(C)[N+](=O)[O-] |
| InChI | InChI=1S/C11H19NO4.C6H8O2.C5H11NO2/c1-3-6-11(2,12(14)15)8-9-5-4-7-16-10(9)13;1-5-3-2-4-8-6(5)7;1-3-4-5(2)6(7)8/h9H,3-8H2,1-2H3;1-4H2;5H,3-4H2,1-2H3 |
| InChIKey | KBLBRQPQQSSSNU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane?
The IUPAC name of 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane (CID 167603539) is 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane.
What is the SMILES notation for 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane?
The canonical SMILES for 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane is C=C1CCCOC1=O.CCCC(C)(CC1CCCOC1=O)[N+](=O)[O-].CCCC(C)[N+](=O)[O-].
What is the InChIKey of 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane?
The InChIKey is KBLBRQPQQSSSNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO4.C6H8O2.C5H11NO2/c1-3-6-11(2,12(14)15)8-9-5-4-7-16-10(9)13;1-5-3-2-4-8-6(5)7;1-3-4-5(2)6(7)8/h9H,3-8H2,1-2H3;1-4H2;5H,3-4H2,1-2H3.
What are the key properties of 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane?
3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane has a molecular weight of 458.55 g/mol, XLogP of 4.50, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylideneoxan-2-one;3-(2-methyl-2-nitropentyl)oxan-2-one;2-nitropentane is sourced from PubChem (CID 167603539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).