About methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one
methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one (PubChem CID 162731056) has the molecular formula C16H27NO6
and a molecular weight of 329.39 g/mol. Its IUPAC name is methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one.
Molecular Properties
| Compound Name | methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one |
| PubChem CID | 162731056 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one |
| SMILES | C.C=C1CCCOC1=O.CC(C)(CC1CCCOC1=O)[N+](=O)[O-] |
| InChI | InChI=1S/C9H15NO4.C6H8O2.CH4/c1-9(2,10(12)13)6-7-4-3-5-14-8(7)11;1-5-3-2-4-8-6(5)7;/h7H,3-6H2,1-2H3;1-4H2;1H4 |
| InChIKey | VWIBXWONZXPUNR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one?
The IUPAC name of methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one (CID 162731056) is methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one.
What is the SMILES notation for methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one?
The canonical SMILES for methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one is C.C=C1CCCOC1=O.CC(C)(CC1CCCOC1=O)[N+](=O)[O-].
What is the InChIKey of methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one?
The InChIKey is VWIBXWONZXPUNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4.C6H8O2.CH4/c1-9(2,10(12)13)6-7-4-3-5-14-8(7)11;1-5-3-2-4-8-6(5)7;/h7H,3-6H2,1-2H3;1-4H2;1H4.
What are the key properties of methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one?
methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one has a molecular weight of 329.39 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one is sourced from PubChem (CID 162731056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).