C25H43NO8 — CID 160967401
ethyl 2-methylidene-7-oxooctanoate;ethyl 2-(2-methyl-2-nitropropyl)-7-oxooctanoate (PubChem CID 160967401) has the molecular formula C25H43NO8 and a molecular weight of 485.62 g/mol. Its IUPAC name is ethyl 2-methylidene-7-oxooctanoate;ethyl 2-(2-methyl-2-nitropropyl)-7-oxooctanoate.
| Compound Name | ethyl 2-methylidene-7-oxooctanoate;ethyl 2-(2-methyl-2-nitropropyl)-7-oxooctanoate |
|---|---|
| PubChem CID | 160967401 |
| Molecular Formula | C25H43NO8 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | ethyl 2-methylidene-7-oxooctanoate;ethyl 2-(2-methyl-2-nitropropyl)-7-oxooctanoate |
| SMILES | C=C(CCCCC(C)=O)C(=O)OCC.CCOC(=O)C(CCCCC(C)=O)CC(C)(C)[N+](=O)[O-] |
| InChI | InChI=1S/C14H25NO5.C11H18O3/c1-5-20-13(17)12(9-7-6-8-11(2)16)10-14(3,4)15(18)19;1-4-14-11(13)9(2)7-5-6-8-10(3)12/h12H,5-10H2,1-4H3;2,4-8H2,1,3H3 |
| InChIKey | SXUOQYNQXYBWDW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|