C12H24N2O2SSi — CID 101498142
(4R)-3-acetyl-2,2-dimethyl-N-(trimethylsilylmethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 101498142) has the molecular formula C12H24N2O2SSi and a molecular weight of 288.49 g/mol. Its IUPAC name is (4R)-3-acetyl-2,2-dimethyl-N-(trimethylsilylmethyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-acetyl-2,2-dimethyl-N-(trimethylsilylmethyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 101498142 |
| Molecular Formula | C12H24N2O2SSi |
| Molecular Weight | 288.49 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (4R)-3-acetyl-2,2-dimethyl-N-(trimethylsilylmethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(=O)N1[C@H](C(=O)NC[Si](C)(C)C)CSC1(C)C |
| InChI | InChI=1S/C12H24N2O2SSi/c1-9(15)14-10(7-17-12(14,2)3)11(16)13-8-18(4,5)6/h10H,7-8H2,1-6H3,(H,13,16)/t10-/m0/s1 |
| InChIKey | UDZALGQDESNUFS-JTQLQIEISA-N |
| XLogP | 1.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|