C14H23NO4S — CID 11507718
(4R)-2,2-dimethyl-3-(2-oxooctanoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 11507718) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-3-(2-oxooctanoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-2,2-dimethyl-3-(2-oxooctanoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 11507718 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (4R)-2,2-dimethyl-3-(2-oxooctanoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCCCC(=O)C(=O)N1[C@H](C(=O)O)CSC1(C)C |
| InChI | InChI=1S/C14H23NO4S/c1-4-5-6-7-8-11(16)12(17)15-10(13(18)19)9-20-14(15,2)3/h10H,4-9H2,1-3H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | TUYXPMMUJSHNMO-JTQLQIEISA-N |
| XLogP | 2.29 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|