C23H28O9 — CID 101499568
[(1R,2R,4R,6S,9Z,11R,13S,14S)-7-formyl-11-hydroxy-6-methoxy-11-methyl-16-oxo-4-prop-1-en-2-yl-15,17,18-trioxatetracyclo[11.2.2.16,9.01,14]octadeca-7,9-dien-2-yl] acetate (PubChem CID 101499568) has the molecular formula C23H28O9 and a molecular weight of 448.47 g/mol. Its IUPAC name is [(1R,2R,4R,6S,9Z,11R,13S,14S)-7-formyl-11-hydroxy-6-methoxy-11-methyl-16-oxo-4-prop-1-en-2-yl-15,17,18-trioxatetracyclo[11.2.2.16,9.01,14]octadeca-7,9-dien-2-yl] acetate.
| Compound Name | [(1R,2R,4R,6S,9Z,11R,13S,14S)-7-formyl-11-hydroxy-6-methoxy-11-methyl-16-oxo-4-prop-1-en-2-yl-15,17,18-trioxatetracyclo[11.2.2.16,9.01,14]octadeca-7,9-dien-2-yl] acetate |
|---|---|
| PubChem CID | 101499568 |
| Molecular Formula | C23H28O9 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [(1R,2R,4R,6S,9Z,11R,13S,14S)-7-formyl-11-hydroxy-6-methoxy-11-methyl-16-oxo-4-prop-1-en-2-yl-15,17,18-trioxatetracyclo[11.2.2.16,9.01,14]octadeca-7,9-dien-2-yl] acetate |
| SMILES | C=C(C)[C@@H]1C[C@@H](OC(C)=O)[C@@]23O[C@H]2[C@H](C[C@@](C)(O)/C=C2/C=C(C=O)[C@](OC)(C1)O2)OC3=O |
| InChI | InChI=1S/C23H28O9/c1-12(2)14-6-18(29-13(3)25)23-19(32-23)17(30-20(23)26)10-21(4,27)9-16-7-15(11-24)22(8-14,28-5)31-16/h7,9,11,14,17-19,27H,1,6,8,10H2,2-5H3/b16-9-/t14-,17+,18-,19+,21+,22+,23-/m1/s1 |
| InChIKey | KDZCQYKLPCTWIZ-MWZMJNQASA-N |
| XLogP | 1.49 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|