C26H30O11 — CID 162819040
(10,11-diacetyloxy-7-formyl-11-methyl-16-oxo-4-prop-1-en-2-yl-15,17,18-trioxatetracyclo[11.2.2.16,9.01,14]octadeca-6,8-dien-2-yl) acetate (PubChem CID 162819040) has the molecular formula C26H30O11 and a molecular weight of 518.52 g/mol. Its IUPAC name is (10,11-diacetyloxy-7-formyl-11-methyl-16-oxo-4-prop-1-en-2-yl-15,17,18-trioxatetracyclo[11.2.2.16,9.01,14]octadeca-6,8-dien-2-yl) acetate.
| Compound Name | (10,11-diacetyloxy-7-formyl-11-methyl-16-oxo-4-prop-1-en-2-yl-15,17,18-trioxatetracyclo[11.2.2.16,9.01,14]octadeca-6,8-dien-2-yl) acetate |
|---|---|
| PubChem CID | 162819040 |
| Molecular Formula | C26H30O11 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | (10,11-diacetyloxy-7-formyl-11-methyl-16-oxo-4-prop-1-en-2-yl-15,17,18-trioxatetracyclo[11.2.2.16,9.01,14]octadeca-6,8-dien-2-yl) acetate |
| SMILES | C=C(C)C1Cc2oc(cc2C=O)C(OC(C)=O)C(C)(OC(C)=O)CC2OC(=O)C3(OC23)C(OC(C)=O)C1 |
| InChI | InChI=1S/C26H30O11/c1-12(2)16-7-18-17(11-27)8-19(34-18)22(33-14(4)29)25(6,36-15(5)30)10-20-23-26(37-23,24(31)35-20)21(9-16)32-13(3)28/h8,11,16,20-23H,1,7,9-10H2,2-6H3 |
| InChIKey | RSZHQKNOVSHFOV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 147.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|