C22H22N2O3S3 — CID 10151681
N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)thiophen-3-yl]-4-phenylbenzenesulfonamide (PubChem CID 10151681) has the molecular formula C22H22N2O3S3 and a molecular weight of 458.63 g/mol. Its IUPAC name is N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)thiophen-3-yl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)thiophen-3-yl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 10151681 |
| Molecular Formula | C22H22N2O3S3 |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)thiophen-3-yl]-4-phenylbenzenesulfonamide |
| SMILES | O=C(Cc1cscc1NS(=O)(=O)c1ccc(-c2ccccc2)cc1)N1CCSCC1 |
| InChI | InChI=1S/C22H22N2O3S3/c25-22(24-10-12-28-13-11-24)14-19-15-29-16-21(19)23-30(26,27)20-8-6-18(7-9-20)17-4-2-1-3-5-17/h1-9,15-16,23H,10-14H2 |
| InChIKey | NQYZWIMVDAFZJW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |