C11H9NO4S2 — CID 70120734
4-(benzenesulfonamido)thiophene-3-carboxylic acid (PubChem CID 70120734) has the molecular formula C11H9NO4S2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-(benzenesulfonamido)thiophene-3-carboxylic acid.
| Compound Name | 4-(benzenesulfonamido)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 70120734 |
| Molecular Formula | C11H9NO4S2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 4-(benzenesulfonamido)thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1cscc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H9NO4S2/c13-11(14)9-6-17-7-10(9)12-18(15,16)8-4-2-1-3-5-8/h1-7,12H,(H,13,14) |
| InChIKey | OHHXJQRLFVNRRK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |