C24H25N3O3S — CID 102563725
1-[[2-[(4-phenylphenyl)sulfonylamino]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 102563725) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-[[2-[(4-phenylphenyl)sulfonylamino]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[[2-[(4-phenylphenyl)sulfonylamino]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 102563725 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-[[2-[(4-phenylphenyl)sulfonylamino]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1Cc1ccccc1NS(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25N3O3S/c25-24(28)23-11-6-16-27(23)17-20-9-4-5-10-22(20)26-31(29,30)21-14-12-19(13-15-21)18-7-2-1-3-8-18/h1-5,7-10,12-15,23,26H,6,11,16-17H2,(H2,25,28) |
| InChIKey | SKCLCBYXPBJEKR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |