C17H21N3OS — CID 97236683
(2R)-1-[[2-(thiophen-3-ylmethylamino)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 97236683) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is (2R)-1-[[2-(thiophen-3-ylmethylamino)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[[2-(thiophen-3-ylmethylamino)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 97236683 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (2R)-1-[[2-(thiophen-3-ylmethylamino)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN1Cc1ccccc1NCc1ccsc1 |
| InChI | InChI=1S/C17H21N3OS/c18-17(21)16-6-3-8-20(16)11-14-4-1-2-5-15(14)19-10-13-7-9-22-12-13/h1-2,4-5,7,9,12,16,19H,3,6,8,10-11H2,(H2,18,21)/t16-/m1/s1 |
| InChIKey | SATQFKRCQXYIOQ-MRXNPFEDSA-N |
| XLogP | 2.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |