C27H27N3O2 — CID 56548081
1-[[2-[[(E)-3-(3-phenylphenyl)prop-2-enoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 56548081) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-[[2-[[(E)-3-(3-phenylphenyl)prop-2-enoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[[2-[[(E)-3-(3-phenylphenyl)prop-2-enoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56548081 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 1-[[2-[[(E)-3-(3-phenylphenyl)prop-2-enoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1Cc1ccccc1NC(=O)/C=C/c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H27N3O2/c28-27(32)25-14-7-17-30(25)19-23-11-4-5-13-24(23)29-26(31)16-15-20-8-6-12-22(18-20)21-9-2-1-3-10-21/h1-6,8-13,15-16,18,25H,7,14,17,19H2,(H2,28,32)(H,29,31)/b16-15+ |
| InChIKey | MCGRKWKLXZGCCD-FOCLMDBBSA-N |
| XLogP | 4.46 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|