C24H24N4O2 — CID 56547950
1-[[2-[[(E)-3-quinolin-8-ylprop-2-enoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 56547950) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-[[2-[[(E)-3-quinolin-8-ylprop-2-enoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[[2-[[(E)-3-quinolin-8-ylprop-2-enoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56547950 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-[[2-[[(E)-3-quinolin-8-ylprop-2-enoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1Cc1ccccc1NC(=O)/C=C/c1cccc2cccnc12 |
| InChI | InChI=1S/C24H24N4O2/c25-24(30)21-11-5-15-28(21)16-19-6-1-2-10-20(19)27-22(29)13-12-18-8-3-7-17-9-4-14-26-23(17)18/h1-4,6-10,12-14,21H,5,11,15-16H2,(H2,25,30)(H,27,29)/b13-12+ |
| InChIKey | AYOWQYVTLUOFDP-OUKQBFOZSA-N |
| XLogP | 3.34 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|